Products 102154-19-8

CAS 102154-19-8 appears in our catalog under these names: 2-Chloronaphthalene-1-sulfonyl chloride, 95%, 2-Chloronaphthalene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

2-chloronaphthalene-1-sulfonyl chloride (CAS 102154-19-8) is a chemical compound with the molecular formula C10H6Cl2O2S and a molecular weight of 261.12 g/mol. IUPAC name: 2-chloronaphthalene-1-sulfonyl chloride. InChIKey: SPRZLGGRDIRMRD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6Cl2O2S
Molecular weight261.12 g/mol
IUPAC name2-chloronaphthalene-1-sulfonyl chloride
InChIKeySPRZLGGRDIRMRD-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC(=C2S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)