CAS 82-74-6 is the registry number for 8-Chloro-1-naphthalenesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
8-chloronaphthalene-1-sulfonyl chloride (CAS 82-74-6) is a chemical compound with the molecular formula C10H6Cl2O2S and a molecular weight of 261.12 g/mol. IUPAC name: 8-chloronaphthalene-1-sulfonyl chloride. InChIKey: WORJISAOMPPPTM-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2O2S |
|---|---|
| Molecular weight | 261.12 g/mol |
| IUPAC name | 8-chloronaphthalene-1-sulfonyl chloride |
| InChIKey | WORJISAOMPPPTM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S(=O)(=O)Cl)C(=CC=C2)Cl |
Computed by PubChem (NCBI)