Products 82-74-6

CAS 82-74-6 is the registry number for 8-Chloro-1-naphthalenesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

8-chloronaphthalene-1-sulfonyl chloride (CAS 82-74-6) is a chemical compound with the molecular formula C10H6Cl2O2S and a molecular weight of 261.12 g/mol. IUPAC name: 8-chloronaphthalene-1-sulfonyl chloride. InChIKey: WORJISAOMPPPTM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6Cl2O2S
Molecular weight261.12 g/mol
IUPAC name8-chloronaphthalene-1-sulfonyl chloride
InChIKeyWORJISAOMPPPTM-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)S(=O)(=O)Cl)C(=CC=C2)Cl

Computed by PubChem (NCBI)