Products 102159-28-4
CAS 102159-28-4 is the registry number for 1-Methyl 2-[bis(4-methylphenyl)methylene]butanedioate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-methoxycarbonyl-4,4-bis(4-methylphenyl)but-3-enoic acid (CAS 102159-28-4) is a chemical compound with the molecular formula C20H20O4 and a molecular weight of 324.4 g/mol. IUPAC name: 3-methoxycarbonyl-4,4-bis(4-methylphenyl)but-3-enoic acid. InChIKey: IHFQSORYTFDIDM-UHFFFAOYSA-N.
| Molecular formula | C20H20O4 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 3-methoxycarbonyl-4,4-bis(4-methylphenyl)but-3-enoic acid |
| InChIKey | IHFQSORYTFDIDM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=C(CC(=O)O)C(=O)OC)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)