Products 1021684-64-9
CAS 1021684-64-9 is the registry number for Bromoamphetamine-d6. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
1-[4-bromo-2,5-bis(trideuteriomethoxy)phenyl]propan-2-amine (CAS 1021684-64-9) is a chemical compound with the molecular formula C11H16BrNO2 and a molecular weight of 280.19 g/mol. IUPAC name: 1-[4-bromo-2,5-bis(trideuteriomethoxy)phenyl]propan-2-amine. InChIKey: FXMWUTGUCAKGQL-XERRXZQWSA-N.
| Molecular formula | C11H16BrNO2 |
|---|---|
| Molecular weight | 280.19 g/mol |
| IUPAC name | 1-[4-bromo-2,5-bis(trideuteriomethoxy)phenyl]propan-2-amine |
| InChIKey | FXMWUTGUCAKGQL-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=C(C=C1CC(C)N)OC([2H])([2H])[2H])Br |
Computed by PubChem (NCBI)