CAS 1108725-80-9 is the registry number for 2,2'-(4-Bromopyridine-2,6-diyl)bis(propan-2-ol), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-bromo-6-(2-hydroxypropan-2-yl)-2-pyridinyl]propan-2-ol (CAS 1108725-80-9) is a chemical compound with the molecular formula C11H16BrNO2 and a molecular weight of 274.15 g/mol. IUPAC name: 2-[4-bromo-6-(2-hydroxypropan-2-yl)-2-pyridinyl]propan-2-ol. InChIKey: VAACVYXJPDERFP-UHFFFAOYSA-N.
| Molecular formula | C11H16BrNO2 |
|---|---|
| Molecular weight | 274.15 g/mol |
| IUPAC name | 2-[4-bromo-6-(2-hydroxypropan-2-yl)-2-pyridinyl]propan-2-ol |
| InChIKey | VAACVYXJPDERFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC(=N1)C(C)(C)O)Br)O |
Computed by PubChem (NCBI)