CAS 932790-03-9 is the registry number for 5-Bromo-N-(3,3-dimethylbutan-2-yl)furan-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(3,3-dimethylbutan-2-yl)furan-2-carboxamide (CAS 932790-03-9) is a chemical compound with the molecular formula C11H16BrNO2 and a molecular weight of 274.15 g/mol. IUPAC name: 5-bromo-N-(3,3-dimethylbutan-2-yl)furan-2-carboxamide. InChIKey: AYGBVZRFJGTEND-UHFFFAOYSA-N.
| Molecular formula | C11H16BrNO2 |
|---|---|
| Molecular weight | 274.15 g/mol |
| IUPAC name | 5-bromo-N-(3,3-dimethylbutan-2-yl)furan-2-carboxamide |
| InChIKey | AYGBVZRFJGTEND-UHFFFAOYSA-N |
| SMILES | CC(C(C)(C)C)NC(=O)C1=CC=C(O1)Br |
Computed by PubChem (NCBI)