CAS 1311314-03-0 appears in our catalog under these names: 2-Amino-5-phenylpentanoic acid hydrobromide, 95%, 2-Amino-5-phenylpentanoic acid hydrobromide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 2,5g.
2-amino-5-phenylpentanoic acid;hydrobromide (CAS 1311314-03-0) is a chemical compound with the molecular formula C11H16BrNO2 and a molecular weight of 274.15 g/mol. IUPAC name: 2-amino-5-phenylpentanoic acid;hydrobromide. InChIKey: FGPFPDOMYWRJSU-UHFFFAOYSA-N.
| Molecular formula | C11H16BrNO2 |
|---|---|
| Molecular weight | 274.15 g/mol |
| IUPAC name | 2-amino-5-phenylpentanoic acid;hydrobromide |
| InChIKey | FGPFPDOMYWRJSU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCC(C(=O)O)N.Br |
Computed by PubChem (NCBI)