CAS 1021871-56-6 appears in our catalog under these names: 2-(3,5-Dichlorophenyl)-2-phenylethylamine hydrochloride, 95%, 2-(3,5-Dichlorophenyl)-2-phenylethanamine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-(3,5-dichlorophenyl)-2-phenylethanamine;hydrochloride (CAS 1021871-56-6) is a chemical compound with the molecular formula C14H14Cl3N and a molecular weight of 302.6 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)-2-phenylethanamine;hydrochloride. InChIKey: CREGFWMDIFQDTE-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl3N |
|---|---|
| Molecular weight | 302.6 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)-2-phenylethanamine;hydrochloride |
| InChIKey | CREGFWMDIFQDTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN)C2=CC(=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)