CAS 63915-67-3 is the registry number for N-Benzyl-1-(2,4-dichlorophenyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Benzyl-[(2,4-dichlorophenyl)methyl]azanium chloride (CAS 63915-67-3) is a chemical compound with the molecular formula C14H14Cl3N and a molecular weight of 302.6 g/mol. IUPAC name: benzyl-[(2,4-dichlorophenyl)methyl]azanium chloride. InChIKey: QDKZAYFEMLDRKT-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl3N |
|---|---|
| Molecular weight | 302.6 g/mol |
| IUPAC name | benzyl-[(2,4-dichlorophenyl)methyl]azanium chloride |
| InChIKey | QDKZAYFEMLDRKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C[NH2+]CC2=C(C=C(C=C2)Cl)Cl.[Cl-] |
Computed by PubChem (NCBI)