Products 63915-67-3

CAS 63915-67-3 is the registry number for N-Benzyl-1-(2,4-dichlorophenyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl-[(2,4-dichlorophenyl)methyl]azanium chloride (CAS 63915-67-3) is a chemical compound with the molecular formula C14H14Cl3N and a molecular weight of 302.6 g/mol. IUPAC name: benzyl-[(2,4-dichlorophenyl)methyl]azanium chloride. InChIKey: QDKZAYFEMLDRKT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14Cl3N
Molecular weight302.6 g/mol
IUPAC namebenzyl-[(2,4-dichlorophenyl)methyl]azanium chloride
InChIKeyQDKZAYFEMLDRKT-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C[NH2+]CC2=C(C=C(C=C2)Cl)Cl.[Cl-]

Computed by PubChem (NCBI)