Products 2572713-70-1
CAS 2572713-70-1 is the registry number for 2-(3',4'-Dichloro-[1,1'-biphenyl]-4-yl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(3,4-dichlorophenyl)phenyl]ethanamine;hydrochloride (CAS 2572713-70-1) is a chemical compound with the molecular formula C14H14Cl3N and a molecular weight of 302.6 g/mol. IUPAC name: 2-[4-(3,4-dichlorophenyl)phenyl]ethanamine;hydrochloride. InChIKey: WJWNUUZNRPTPRN-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl3N |
|---|---|
| Molecular weight | 302.6 g/mol |
| IUPAC name | 2-[4-(3,4-dichlorophenyl)phenyl]ethanamine;hydrochloride |
| InChIKey | WJWNUUZNRPTPRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCN)C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)