CAS 1279852-41-3 appears in our catalog under these names: 1-(3,5-Dichlorophenyl)-2-phenylethan-1-amine hydrochloride, 95%, 1-(3,5-Dichlorophenyl)-2-phenylethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(3,5-dichlorophenyl)-2-phenylethanamine;hydrochloride (CAS 1279852-41-3) is a chemical compound with the molecular formula C14H14Cl3N and a molecular weight of 302.6 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-2-phenylethanamine;hydrochloride. InChIKey: MKHYOLXDPKHKCL-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl3N |
|---|---|
| Molecular weight | 302.6 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-2-phenylethanamine;hydrochloride |
| InChIKey | MKHYOLXDPKHKCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C2=CC(=CC(=C2)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)