CAS 1021874-40-7 is the registry number for 6-Acetylisoindolin-1-one, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-acetyl-2,3-dihydroisoindol-1-one (CAS 1021874-40-7) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 6-acetyl-2,3-dihydroisoindol-1-one. InChIKey: BONOBVZICFQMKM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 6-acetyl-2,3-dihydroisoindol-1-one |
| InChIKey | BONOBVZICFQMKM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(CNC2=O)C=C1 |
Computed by PubChem (NCBI)