Products 1021934-03-1
CAS 1021934-03-1 appears in our catalog under these names: (S)–O–Desmethyl Venlafaxine N–Oxide, (S)-O-Desmethyl Venlafaxine N-Oxide. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
(2S)-2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)-N,N-dimethylethanamine oxide (CAS 1021934-03-1) is a chemical compound with the molecular formula C16H25NO3 and a molecular weight of 279.37 g/mol. IUPAC name: (2S)-2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)-N,N-dimethylethanamine oxide. InChIKey: CZFVXEWRFNKSSC-OAHLLOKOSA-N.
| Molecular formula | C16H25NO3 |
|---|---|
| Molecular weight | 279.37 g/mol |
| IUPAC name | (2S)-2-(1-hydroxycyclohexyl)-2-(4-hydroxyphenyl)-N,N-dimethylethanamine oxide |
| InChIKey | CZFVXEWRFNKSSC-OAHLLOKOSA-N |
| SMILES | C[N+](C)(C[C@H](C1=CC=C(C=C1)O)C2(CCCCC2)O)[O-] |
Computed by PubChem (NCBI)