Products 47092-75-1
CAS 47092-75-1 appears in our catalog under these names: Butamirate Impurity 2, Alpha-Desethyl Butamirate, >95% (HPLC), 2-(2-(Diethylamino)ethoxy)ethyl 2-Phenylacetate, α-Desethyl butamirate. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg.
2-[2-(diethylamino)ethoxy]ethyl 2-phenylacetate (CAS 47092-75-1) is a chemical compound with the molecular formula C16H25NO3 and a molecular weight of 279.37 g/mol. IUPAC name: 2-[2-(diethylamino)ethoxy]ethyl 2-phenylacetate. InChIKey: UCLWHTMFRLINOQ-UHFFFAOYSA-N.
| Molecular formula | C16H25NO3 |
|---|---|
| Molecular weight | 279.37 g/mol |
| IUPAC name | 2-[2-(diethylamino)ethoxy]ethyl 2-phenylacetate |
| InChIKey | UCLWHTMFRLINOQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOCCOC(=O)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)