Products 238762-31-7
CAS 238762-31-7 appears in our catalog under these names: Salbutamol Impurity 22, Salbutamol Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2-(tert-butylamino)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol (CAS 238762-31-7) is a chemical compound with the molecular formula C16H25NO3 and a molecular weight of 279.37 g/mol. IUPAC name: (1R)-2-(tert-butylamino)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol. InChIKey: FNNNRZNBSYVOCP-ZDUSSCGKSA-N.
| Molecular formula | C16H25NO3 |
|---|---|
| Molecular weight | 279.37 g/mol |
| IUPAC name | (1R)-2-(tert-butylamino)-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanol |
| InChIKey | FNNNRZNBSYVOCP-ZDUSSCGKSA-N |
| SMILES | CC1(OCC2=C(O1)C=CC(=C2)[C@H](CNC(C)(C)C)O)C |
Computed by PubChem (NCBI)