Products 147686-70-2

CAS 147686-70-2 is the registry number for Methyl 5-(4-amino-2,5-dimethylphenoxy)-2,2-dimethylpentanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 5-(4-amino-2,5-dimethylphenoxy)-2,2-dimethylpentanoate (CAS 147686-70-2) is a chemical compound with the molecular formula C16H25NO3 and a molecular weight of 279.37 g/mol. IUPAC name: methyl 5-(4-amino-2,5-dimethylphenoxy)-2,2-dimethylpentanoate. InChIKey: QFUPHJNEMZEAGM-UHFFFAOYSA-N.

Identity
Molecular formulaC16H25NO3
Molecular weight279.37 g/mol
IUPAC namemethyl 5-(4-amino-2,5-dimethylphenoxy)-2,2-dimethylpentanoate
InChIKeyQFUPHJNEMZEAGM-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1OCCCC(C)(C)C(=O)OC)C)N

Computed by PubChem (NCBI)