CAS 1021939-75-2 is the registry number for 3-(4-Bromo-2-fluorophenyl)propanoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(4-bromo-2-fluorophenyl)propanoyl chloride (CAS 1021939-75-2) is a chemical compound with the molecular formula C9H7BrClFO and a molecular weight of 265.50 g/mol. IUPAC name: 3-(4-bromo-2-fluorophenyl)propanoyl chloride. InChIKey: BLPTXOJOTJJSMY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClFO |
|---|---|
| Molecular weight | 265.50 g/mol |
| IUPAC name | 3-(4-bromo-2-fluorophenyl)propanoyl chloride |
| InChIKey | BLPTXOJOTJJSMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)CCC(=O)Cl |
Computed by PubChem (NCBI)