Products 2375271-19-3

CAS 2375271-19-3 is the registry number for 3-(2-Bromo-4-fluorophenyl)propanoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(2-bromo-4-fluorophenyl)propanoyl chloride (CAS 2375271-19-3) is a chemical compound with the molecular formula C9H7BrClFO and a molecular weight of 265.50 g/mol. IUPAC name: 3-(2-bromo-4-fluorophenyl)propanoyl chloride. InChIKey: JSCCCUMXHZOFAY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrClFO
Molecular weight265.50 g/mol
IUPAC name3-(2-bromo-4-fluorophenyl)propanoyl chloride
InChIKeyJSCCCUMXHZOFAY-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)Br)CCC(=O)Cl

Computed by PubChem (NCBI)