CAS 2055840-29-2 is the registry number for 7-Bromo-6-fluoro-2,3-dihydro-1h-inden-1-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
7-bromo-6-fluoro-2,3-dihydroinden-1-one;hydrochloride (CAS 2055840-29-2) is a chemical compound with the molecular formula C9H7BrClFO and a molecular weight of 265.50 g/mol. IUPAC name: 7-bromo-6-fluoro-2,3-dihydroinden-1-one;hydrochloride. InChIKey: AAQQSDWUJWQSIM-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClFO |
|---|---|
| Molecular weight | 265.50 g/mol |
| IUPAC name | 7-bromo-6-fluoro-2,3-dihydroinden-1-one;hydrochloride |
| InChIKey | AAQQSDWUJWQSIM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2Br)F.Cl |
Computed by PubChem (NCBI)