Products 2352609-38-0
CAS 2352609-38-0 is the registry number for 1-(6-Bromo-3-chloro-2-fluorophenyl)propan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(6-bromo-3-chloro-2-fluorophenyl)propan-1-one (CAS 2352609-38-0) is a chemical compound with the molecular formula C9H7BrClFO and a molecular weight of 265.50 g/mol. IUPAC name: 1-(6-bromo-3-chloro-2-fluorophenyl)propan-1-one. InChIKey: AUNSDWFAYXODIN-UHFFFAOYSA-N.
| Molecular formula | C9H7BrClFO |
|---|---|
| Molecular weight | 265.50 g/mol |
| IUPAC name | 1-(6-bromo-3-chloro-2-fluorophenyl)propan-1-one |
| InChIKey | AUNSDWFAYXODIN-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=CC(=C1F)Cl)Br |
Computed by PubChem (NCBI)