CAS 1022104-58-0 is the registry number for 4-methoxy-3-(4-(phenylamino)(3,5-thiazolyl))phenol. Offered by: Biosynth. Available pack sizes: 250mg.
3-(2-anilino-1,3-thiazol-4-yl)-4-methoxyphenol (CAS 1022104-58-0) is a chemical compound with the molecular formula C16H14N2O2S and a molecular weight of 298.4 g/mol. IUPAC name: 3-(2-anilino-1,3-thiazol-4-yl)-4-methoxyphenol. InChIKey: BRNODEVQWRVVQJ-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2S |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 3-(2-anilino-1,3-thiazol-4-yl)-4-methoxyphenol |
| InChIKey | BRNODEVQWRVVQJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)O)C2=CSC(=N2)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)