Products 1022120-98-4
CAS 1022120-98-4 is the registry number for 4-chlorophenyl 3-methyl-5-phenylpyrazolyl ketone. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 250mg, 100mg.
(4-chlorophenyl)-(3-methyl-5-phenylpyrazol-1-yl)methanone (CAS 1022120-98-4) is a chemical compound with the molecular formula C17H13ClN2O and a molecular weight of 296.7 g/mol. IUPAC name: (4-chlorophenyl)-(3-methyl-5-phenylpyrazol-1-yl)methanone. InChIKey: NRIRCRMTRGWHSA-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O |
|---|---|
| Molecular weight | 296.7 g/mol |
| IUPAC name | (4-chlorophenyl)-(3-methyl-5-phenylpyrazol-1-yl)methanone |
| InChIKey | NRIRCRMTRGWHSA-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C2=CC=CC=C2)C(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)