CAS 956373-98-1 is the registry number for 1-Benzyl-3-(4-chlorophenyl)-1h-pyrazole-4-carbaldehyde, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
1-benzyl-3-(4-chlorophenyl)pyrazole-4-carbaldehyde (CAS 956373-98-1) is a chemical compound with the molecular formula C17H13ClN2O and a molecular weight of 296.7 g/mol. IUPAC name: 1-benzyl-3-(4-chlorophenyl)pyrazole-4-carbaldehyde. InChIKey: ZXIUTKHOQURDOG-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O |
|---|---|
| Molecular weight | 296.7 g/mol |
| IUPAC name | 1-benzyl-3-(4-chlorophenyl)pyrazole-4-carbaldehyde |
| InChIKey | ZXIUTKHOQURDOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C(=N2)C3=CC=C(C=C3)Cl)C=O |
Computed by PubChem (NCBI)