CAS 1203183-98-5 is the registry number for 7,8-Dimethyl-2-pyridin-4-ylquinoline-4-carbonyl chloride hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
7,8-dimethyl-2-pyridin-4-ylquinoline-4-carbonyl chloride (CAS 1203183-98-5) is a chemical compound with the molecular formula C17H13ClN2O and a molecular weight of 296.7 g/mol. IUPAC name: 7,8-dimethyl-2-pyridin-4-ylquinoline-4-carbonyl chloride. InChIKey: MCFBMUOBVSIKDG-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O |
|---|---|
| Molecular weight | 296.7 g/mol |
| IUPAC name | 7,8-dimethyl-2-pyridin-4-ylquinoline-4-carbonyl chloride |
| InChIKey | MCFBMUOBVSIKDG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=N2)C3=CC=NC=C3)C(=O)Cl)C |
Computed by PubChem (NCBI)