CAS 1203043-76-8 is the registry number for 8-Ethyl-2-pyridin-2-ylquinoline-4-carbonyl chloride hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
8-ethyl-2-pyridin-2-ylquinoline-4-carbonyl chloride (CAS 1203043-76-8) is a chemical compound with the molecular formula C17H13ClN2O and a molecular weight of 296.7 g/mol. IUPAC name: 8-ethyl-2-pyridin-2-ylquinoline-4-carbonyl chloride. InChIKey: FCUYHUWDDCXGGV-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O |
|---|---|
| Molecular weight | 296.7 g/mol |
| IUPAC name | 8-ethyl-2-pyridin-2-ylquinoline-4-carbonyl chloride |
| InChIKey | FCUYHUWDDCXGGV-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C(=CC(=N2)C3=CC=CC=N3)C(=O)Cl |
Computed by PubChem (NCBI)