CAS 1022394-38-2 is the registry number for 2-(4-methoxyphenyl)-3-((5-methylisoxazol-3-yl)amino)inden-1-one. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
2-(4-methoxyphenyl)-3-[(5-methyl-1,2-oxazol-3-yl)amino]inden-1-one (CAS 1022394-38-2) is a chemical compound with the molecular formula C20H16N2O3 and a molecular weight of 332.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-3-[(5-methyl-1,2-oxazol-3-yl)amino]inden-1-one. InChIKey: WBABJRGVKOEJRK-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O3 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-3-[(5-methyl-1,2-oxazol-3-yl)amino]inden-1-one |
| InChIKey | WBABJRGVKOEJRK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NC2=C(C(=O)C3=CC=CC=C32)C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)