Products 109653-40-9
CAS 109653-40-9 is the registry number for 2-((4-(Phenylamino)phenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-anilinophenyl)carbamoyl]benzoic acid (CAS 109653-40-9) is a chemical compound with the molecular formula C20H16N2O3 and a molecular weight of 332.4 g/mol. IUPAC name: 2-[(4-anilinophenyl)carbamoyl]benzoic acid. InChIKey: GSVWKNUFLUTEKV-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O3 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 2-[(4-anilinophenyl)carbamoyl]benzoic acid |
| InChIKey | GSVWKNUFLUTEKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)NC(=O)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-((4-(Phenylamino)phenyl)carbamoyl)benzoic acid, N-(4-Phenylamino-phenyl)-phthalamic acid, 2-[(4-anilinophenyl)carbamoyl]benzoic acid, 2-{[4-(phenylamino)phenyl]carbamoyl}benzoic acid, Oprea1_587203, Oprea1_854184, 2-[(4-anilinoanilino)carbonyl]benzoic acid, 2-{N-[4-(phenylamino)phenyl]carbamoyl}benzoic acid