CAS 2523199-93-9 is the registry number for Repibresib. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3-hydroxy-2-phenoxyphenyl)-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one (CAS 2523199-93-9) is a chemical compound with the molecular formula C20H16N2O3 and a molecular weight of 332.4 g/mol. IUPAC name: 4-(3-hydroxy-2-phenoxyphenyl)-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one. InChIKey: IYQNLEOCTFTMJE-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O3 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 4-(3-hydroxy-2-phenoxyphenyl)-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
| InChIKey | IYQNLEOCTFTMJE-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C(C1=O)NC=C2)C3=C(C(=CC=C3)O)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)