Products 308294-72-6
CAS 308294-72-6 appears in our catalog under these names: 3-[1-(2-Furyl)-2-nitroethyl]-2-phenyl-1h-indole, 95%, 3-(1-(Furan-2-yl)-2-nitroethyl)-2-phenyl-1H-indole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-[1-(furan-2-yl)-2-nitroethyl]-2-phenyl-1H-indole (CAS 308294-72-6) is a chemical compound with the molecular formula C20H16N2O3 and a molecular weight of 332.4 g/mol. IUPAC name: 3-[1-(furan-2-yl)-2-nitroethyl]-2-phenyl-1H-indole. InChIKey: RYOZXDJCTOEOFN-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O3 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 3-[1-(furan-2-yl)-2-nitroethyl]-2-phenyl-1H-indole |
| InChIKey | RYOZXDJCTOEOFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=CC=CC=C3N2)C(C[N+](=O)[O-])C4=CC=CO4 |
Computed by PubChem (NCBI)