Products 1022423-36-4
CAS 1022423-36-4 is the registry number for 2-(2-(2,4-dichlorophenyl)-2-oxoethyl)-5-methylcyclohexane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[2-(2,4-dichlorophenyl)-2-oxoethyl]-5-methylcyclohexane-1,3-dione (CAS 1022423-36-4) is a chemical compound with the molecular formula C15H14Cl2O3 and a molecular weight of 313.2 g/mol. IUPAC name: 2-[2-(2,4-dichlorophenyl)-2-oxoethyl]-5-methylcyclohexane-1,3-dione. InChIKey: UNYUFZQCWLSEGQ-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2O3 |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 2-[2-(2,4-dichlorophenyl)-2-oxoethyl]-5-methylcyclohexane-1,3-dione |
| InChIKey | UNYUFZQCWLSEGQ-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C(C(=O)C1)CC(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)