Products 102269-46-5
CAS 102269-46-5 is the registry number for Ethyl 6-(furan-2-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylate, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 6-(furan-2-yl)-4-oxo-1H-quinoline-3-carboxylate (CAS 102269-46-5) is a chemical compound with the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. IUPAC name: ethyl 6-(furan-2-yl)-4-oxo-1H-quinoline-3-carboxylate. InChIKey: VYOKKCCFWMCXPC-UHFFFAOYSA-N.
| Molecular formula | C16H13NO4 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | ethyl 6-(furan-2-yl)-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | VYOKKCCFWMCXPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)C3=CC=CO3 |
Computed by PubChem (NCBI)