CAS 1022922-16-2 appears in our catalog under these names: 2-Chloro-5-(trifluoromethoxy)phenylboronic acid, 98%, (2-Chloro-5-(trifluoromethoxy)phenyl)boronic acid 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
[2-chloro-5-(trifluoromethoxy)phenyl]boronic acid (CAS 1022922-16-2) is a chemical compound with the molecular formula C7H5BClF3O3 and a molecular weight of 240.37 g/mol. IUPAC name: [2-chloro-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: BAEHYECKXGVYKR-UHFFFAOYSA-N.
| Molecular formula | C7H5BClF3O3 |
|---|---|
| Molecular weight | 240.37 g/mol |
| IUPAC name | [2-chloro-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | BAEHYECKXGVYKR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(F)(F)F)Cl)(O)O |
Computed by PubChem (NCBI)