CAS 870822-79-0 appears in our catalog under these names: 3-Chloro-4-(trifluoromethoxy)phenylboronic Acid, 3-Chloro-4-(trifluoromethoxy)phenylboronic acid 98%, 3-Chloro-4-(trifluoromethoxy)phenylboronic acid, 98%, 98%, (3-Chloro-4-(trifluoromethoxy)phenyl)boronic acid, 97%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g.
[3-chloro-4-(trifluoromethoxy)phenyl]boronic acid (CAS 870822-79-0) is a chemical compound with the molecular formula C7H5BClF3O3 and a molecular weight of 240.37 g/mol. IUPAC name: [3-chloro-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: LNHZFDNECMPGHG-UHFFFAOYSA-N.
| Molecular formula | C7H5BClF3O3 |
|---|---|
| Molecular weight | 240.37 g/mol |
| IUPAC name | [3-chloro-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | LNHZFDNECMPGHG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(F)(F)F)Cl)(O)O |
Computed by PubChem (NCBI)