CAS 1095990-65-0 appears in our catalog under these names: (4-Chloro-2-(trifluoromethoxy)phenyl)boronic acid, 95%, [4-chloro-2-(trifluoromethoxy)phenyl]boronic acid, ≥99.3%, ≥99.3%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
[4-chloro-2-(trifluoromethoxy)phenyl]boronic acid (CAS 1095990-65-0) is a chemical compound with the molecular formula C7H5BClF3O3 and a molecular weight of 240.37 g/mol. IUPAC name: [4-chloro-2-(trifluoromethoxy)phenyl]boronic acid. InChIKey: MAJXPZGBHKOIRO-UHFFFAOYSA-N.
| Molecular formula | C7H5BClF3O3 |
|---|---|
| Molecular weight | 240.37 g/mol |
| IUPAC name | [4-chloro-2-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | MAJXPZGBHKOIRO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)