Products 1023-20-7

CAS 1023-20-7 appears in our catalog under these names: Tolperisone Impurity 4, Tolperisone Impurity C, Tolperisone Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-(4-methylphenyl)-3-piperidin-1-ylpropan-1-one;hydrochloride (CAS 1023-20-7) is a chemical compound with the molecular formula C15H22ClNO and a molecular weight of 267.79 g/mol. IUPAC name: 1-(4-methylphenyl)-3-piperidin-1-ylpropan-1-one;hydrochloride. InChIKey: GDXXLEKTBGMZDA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22ClNO
Molecular weight267.79 g/mol
IUPAC name1-(4-methylphenyl)-3-piperidin-1-ylpropan-1-one;hydrochloride
InChIKeyGDXXLEKTBGMZDA-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C(=O)CCN2CCCCC2.Cl

Computed by PubChem (NCBI)