CAS 2703775-24-8 is the registry number for (5-(3,5-Dimethylphenyl)-3-azabicyclo[3.1.1]heptan-1-yl)methanol hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-(3,5-dimethylphenyl)-3-azabicyclo[3.1.1]heptan-1-yl]methanol;hydrochloride (CAS 2703775-24-8) is a chemical compound with the molecular formula C15H22ClNO and a molecular weight of 267.79 g/mol. IUPAC name: [5-(3,5-dimethylphenyl)-3-azabicyclo[3.1.1]heptan-1-yl]methanol;hydrochloride. InChIKey: BSVROCDIUNIQID-UHFFFAOYSA-N.
| Molecular formula | C15H22ClNO |
|---|---|
| Molecular weight | 267.79 g/mol |
| IUPAC name | [5-(3,5-dimethylphenyl)-3-azabicyclo[3.1.1]heptan-1-yl]methanol;hydrochloride |
| InChIKey | BSVROCDIUNIQID-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C23CC(C2)(CNC3)CO)C.Cl |
Computed by PubChem (NCBI)