Products 186521-83-5

CAS 186521-83-5 is the registry number for N,N-Didesmethyl 1-Hydroxy Sibutramine (Mixture of Diastereomers). Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-amino-4-[1-(4-chlorophenyl)cyclobutyl]-2-methylbutan-1-ol (CAS 186521-83-5) is a chemical compound with the molecular formula C15H22ClNO and a molecular weight of 267.79 g/mol. IUPAC name: 4-amino-4-[1-(4-chlorophenyl)cyclobutyl]-2-methylbutan-1-ol. InChIKey: XHDVFYPZKKBQMD-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22ClNO
Molecular weight267.79 g/mol
IUPAC name4-amino-4-[1-(4-chlorophenyl)cyclobutyl]-2-methylbutan-1-ol
InChIKeyXHDVFYPZKKBQMD-UHFFFAOYSA-N
SMILESCC(CC(C1(CCC1)C2=CC=C(C=C2)Cl)N)CO

Computed by PubChem (NCBI)