CAS 923248-45-7 appears in our catalog under these names: 2-Chloro-n-[1-(4-isopropylphenyl)-2-methylpropyl]acetamide, 95%, 2-Chloro-N-{2-methyl-1-(4-(propan-2-yl)phenyl)propyl}acetamide, 95%, 2-Chloro-N-{2-methyl-1-(4-(propan-2-yl)phenyl)propyl}acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-chloro-N-[2-methyl-1-(4-propan-2-ylphenyl)propyl]acetamide (CAS 923248-45-7) is a chemical compound with the molecular formula C15H22ClNO and a molecular weight of 267.79 g/mol. IUPAC name: 2-chloro-N-[2-methyl-1-(4-propan-2-ylphenyl)propyl]acetamide. InChIKey: ZUZCOINWKDETRD-UHFFFAOYSA-N.
| Molecular formula | C15H22ClNO |
|---|---|
| Molecular weight | 267.79 g/mol |
| IUPAC name | 2-chloro-N-[2-methyl-1-(4-propan-2-ylphenyl)propyl]acetamide |
| InChIKey | ZUZCOINWKDETRD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(C(C)C)NC(=O)CCl |
Computed by PubChem (NCBI)