CAS 1023504-75-7 is the registry number for N-(2,3-dimethyl-5-oxo-1-phenyl(3-pyrazolin-4-yl))(3-phenoxyphenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-phenoxybenzamide (CAS 1023504-75-7) is a chemical compound with the molecular formula C24H21N3O3 and a molecular weight of 399.4 g/mol. IUPAC name: N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-phenoxybenzamide. InChIKey: YHZZKPLSWJODRH-UHFFFAOYSA-N.
| Molecular formula | C24H21N3O3 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-phenoxybenzamide |
| InChIKey | YHZZKPLSWJODRH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)NC(=O)C3=CC(=CC=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)