CAS 1349708-89-9 is the registry number for ((1,3,5-Triazine-2,4,6-triyl)tris(benzene-3,1-diyl))trimethanol, 95%. Offered by: Ambeed. Available pack sizes: 1g.
[3-[4,6-bis[3-(hydroxymethyl)phenyl]-1,3,5-triazin-2-yl]phenyl]methanol (CAS 1349708-89-9) is a chemical compound with the molecular formula C24H21N3O3 and a molecular weight of 399.4 g/mol. IUPAC name: [3-[4,6-bis[3-(hydroxymethyl)phenyl]-1,3,5-triazin-2-yl]phenyl]methanol. InChIKey: NQQXMZFFORWTSM-UHFFFAOYSA-N.
| Molecular formula | C24H21N3O3 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | [3-[4,6-bis[3-(hydroxymethyl)phenyl]-1,3,5-triazin-2-yl]phenyl]methanol |
| InChIKey | NQQXMZFFORWTSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC(=NC(=N2)C3=CC=CC(=C3)CO)C4=CC=CC(=C4)CO)CO |
Computed by PubChem (NCBI)