Products 2389235-01-0

CAS 2389235-01-0 is the registry number for Amelenodor, 98.11%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 1 g, 100 mg, 50 mg, 10mM/1mL.

Structural formula: {0} (CAS {1})

2-[3,5-bis[(6-methyl-2-pyridinyl)oxy]phenoxy]-6-methylpyridine (CAS 2389235-01-0) is a chemical compound with the molecular formula C24H21N3O3 and a molecular weight of 399.4 g/mol. IUPAC name: 2-[3,5-bis[(6-methyl-2-pyridinyl)oxy]phenoxy]-6-methylpyridine. InChIKey: OPUQKVNCXCWRLR-UHFFFAOYSA-N.

Identity
Molecular formulaC24H21N3O3
Molecular weight399.4 g/mol
IUPAC name2-[3,5-bis[(6-methyl-2-pyridinyl)oxy]phenoxy]-6-methylpyridine
InChIKeyOPUQKVNCXCWRLR-UHFFFAOYSA-N
SMILESCC1=NC(=CC=C1)OC2=CC(=CC(=C2)OC3=CC=CC(=N3)C)OC4=CC=CC(=N4)C

Computed by PubChem (NCBI)