CAS 1374601-41-8 appears in our catalog under these names: BRD9539/ 98%, BRD9539, BRD9539, 98%, 98%, BRD9539, 99.73%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10 mg.
2-benzamido-1-(3-phenylpropyl)benzimidazole-5-carboxylic acid (CAS 1374601-41-8) is a chemical compound with the molecular formula C24H21N3O3 and a molecular weight of 399.4 g/mol. IUPAC name: 2-benzamido-1-(3-phenylpropyl)benzimidazole-5-carboxylic acid. InChIKey: WPXMEOBILYVKBC-UHFFFAOYSA-N.
| Molecular formula | C24H21N3O3 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 2-benzamido-1-(3-phenylpropyl)benzimidazole-5-carboxylic acid |
| InChIKey | WPXMEOBILYVKBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCN2C3=C(C=C(C=C3)C(=O)O)N=C2NC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)