Products 1023506-65-1
CAS 1023506-65-1 is the registry number for 1-(2-(4-toluenesulphonyl)acetyl)-4-phenylsemicarbazide. Offered by: Biosynth. Available pack sizes: 250mg.
1-[[2-(4-methylphenyl)sulfonylacetyl]amino]-3-phenylurea (CAS 1023506-65-1) is a chemical compound with the molecular formula C16H17N3O4S and a molecular weight of 347.4 g/mol. IUPAC name: 1-[[2-(4-methylphenyl)sulfonylacetyl]amino]-3-phenylurea. InChIKey: PLNPGGRIALYWPA-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 1-[[2-(4-methylphenyl)sulfonylacetyl]amino]-3-phenylurea |
| InChIKey | PLNPGGRIALYWPA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CC(=O)NNC(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)