Products 1023510-94-2
CAS 1023510-94-2 is the registry number for 1-(2-(3,5-dimethylphenoxy)propanoyl)-4-phenylsemicarbazide. Offered by: Biosynth. Available pack sizes: 250mg.
2-(3,5-dimethylphenoxy)-N-(phenylcarbamoyl)propanamide (CAS 1023510-94-2) is a chemical compound with the molecular formula C18H20N2O3 and a molecular weight of 312.4 g/mol. IUPAC name: 2-(3,5-dimethylphenoxy)-N-(phenylcarbamoyl)propanamide. InChIKey: CZWRDRXEHVIQLY-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O3 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 2-(3,5-dimethylphenoxy)-N-(phenylcarbamoyl)propanamide |
| InChIKey | CZWRDRXEHVIQLY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OC(C)C(=O)NC(=O)NC2=CC=CC=C2)C |
Computed by PubChem (NCBI)