CAS 1023532-71-9 is the registry number for 4-(3,4-dihydrobeta-carbolinyl)-5-methyl-3-phenylisoxazole. Offered by: Biosynth. Available pack sizes: 250mg.
4-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-5-methyl-3-phenyl-1,2-oxazole (CAS 1023532-71-9) is a chemical compound with the molecular formula C21H17N3O and a molecular weight of 327.4 g/mol. IUPAC name: 4-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-5-methyl-3-phenyl-1,2-oxazole. InChIKey: UFPBQCFNCLNKEA-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 4-(4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-5-methyl-3-phenyl-1,2-oxazole |
| InChIKey | UFPBQCFNCLNKEA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C3=NCCC4=C3NC5=CC=CC=C45 |
Computed by PubChem (NCBI)