CAS 2460172-78-3 appears in our catalog under these names: (S)-4-Benzyl-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydrooxazole, 98%, (S)-4-Benzyl-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydrooxazole 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg.
(4S)-4-benzyl-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydro-1,3-oxazole (CAS 2460172-78-3) is a chemical compound with the molecular formula C21H17N3O and a molecular weight of 327.4 g/mol. IUPAC name: (4S)-4-benzyl-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydro-1,3-oxazole. InChIKey: XXRWHLDYQFXCSU-HNNXBMFYSA-N.
| Molecular formula | C21H17N3O |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (4S)-4-benzyl-2-(9H-pyrido[3,4-b]indol-1-yl)-4,5-dihydro-1,3-oxazole |
| InChIKey | XXRWHLDYQFXCSU-HNNXBMFYSA-N |
| SMILES | C1[C@@H](N=C(O1)C2=NC=CC3=C2NC4=CC=CC=C34)CC5=CC=CC=C5 |
Computed by PubChem (NCBI)