CAS 708284-62-2 is the registry number for 4-(1H-Benzimidazol-2-yl)-1-(1-naphthyl)pyrrolidin-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(1H-benzimidazol-2-yl)-1-naphthalen-1-ylpyrrolidin-2-one (CAS 708284-62-2) is a chemical compound with the molecular formula C21H17N3O and a molecular weight of 327.4 g/mol. IUPAC name: 4-(1H-benzimidazol-2-yl)-1-naphthalen-1-ylpyrrolidin-2-one. InChIKey: CEVLVWKLFYVNIV-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 4-(1H-benzimidazol-2-yl)-1-naphthalen-1-ylpyrrolidin-2-one |
| InChIKey | CEVLVWKLFYVNIV-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=CC3=CC=CC=C32)C4=NC5=CC=CC=C5N4 |
Computed by PubChem (NCBI)