CAS 2460172-81-8 is the registry number for (S)-4-Benzyl-2-(9H-pyrido[3,4-b]indol-3-yl)-4,5-dihydrooxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-benzyl-2-(9H-pyrido[3,4-b]indol-3-yl)-4,5-dihydro-1,3-oxazole (CAS 2460172-81-8) is a chemical compound with the molecular formula C21H17N3O and a molecular weight of 327.4 g/mol. IUPAC name: 4-benzyl-2-(9H-pyrido[3,4-b]indol-3-yl)-4,5-dihydro-1,3-oxazole. InChIKey: LCNDNCYRXPNABS-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 4-benzyl-2-(9H-pyrido[3,4-b]indol-3-yl)-4,5-dihydro-1,3-oxazole |
| InChIKey | LCNDNCYRXPNABS-UHFFFAOYSA-N |
| SMILES | C1C(N=C(O1)C2=NC=C3C(=C2)C4=CC=CC=C4N3)CC5=CC=CC=C5 |
Computed by PubChem (NCBI)