Products 1023535-97-8
CAS 1023535-97-8 is the registry number for (2-(2,4-dimethylphenoxy)(3-pyridyl))-N-(8-quinolyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-(2,4-dimethylphenoxy)-N-quinolin-8-ylpyridine-3-carboxamide (CAS 1023535-97-8) is a chemical compound with the molecular formula C23H19N3O2 and a molecular weight of 369.4 g/mol. IUPAC name: 2-(2,4-dimethylphenoxy)-N-quinolin-8-ylpyridine-3-carboxamide. InChIKey: JBRRSUOBCOFXKA-UHFFFAOYSA-N.
| Molecular formula | C23H19N3O2 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 2-(2,4-dimethylphenoxy)-N-quinolin-8-ylpyridine-3-carboxamide |
| InChIKey | JBRRSUOBCOFXKA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC2=C(C=CC=N2)C(=O)NC3=CC=CC4=C3N=CC=C4)C |
Computed by PubChem (NCBI)