CAS 1023557-54-1 is the registry number for 2-((1H-indazol-6-ylamino)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
3-hydroxy-2-(1H-indazol-6-yliminomethyl)inden-1-one (CAS 1023557-54-1) is a chemical compound with the molecular formula C17H11N3O2 and a molecular weight of 289.29 g/mol. IUPAC name: 3-hydroxy-2-(1H-indazol-6-yliminomethyl)inden-1-one. InChIKey: QXSGISDIXHESMN-UHFFFAOYSA-N.
| Molecular formula | C17H11N3O2 |
|---|---|
| Molecular weight | 289.29 g/mol |
| IUPAC name | 3-hydroxy-2-(1H-indazol-6-yliminomethyl)inden-1-one |
| InChIKey | QXSGISDIXHESMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C2=O)C=NC3=CC4=C(C=C3)C=NN4)O |
Computed by PubChem (NCBI)